Products 1119391-76-2
CAS 1119391-76-2 is the registry number for 1-(2-(2,2-dimethyl(3-oxaindan-4-yloxy))acetyl)-3-(phenyl)urea. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(phenylcarbamoyl)acetamide (CAS 1119391-76-2) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(phenylcarbamoyl)acetamide. InChIKey: FIEOMSDKPJTVIB-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(phenylcarbamoyl)acetamide |
| InChIKey | FIEOMSDKPJTVIB-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)OCC(=O)NC(=O)NC3=CC=CC=C3)C |
Computed by PubChem (NCBI)