CAS 1119452-66-2 is the registry number for 6-(Chloromethyl)-3-tetrahydrofuran-2-yl[1,2,4]triazolo[4,3-a]pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(chloromethyl)-3-(oxolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine (CAS 1119452-66-2) is a chemical compound with the molecular formula C11H12ClN3O and a molecular weight of 237.68 g/mol. IUPAC name: 6-(chloromethyl)-3-(oxolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: SJVMASSOHNFTKR-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 6-(chloromethyl)-3-(oxolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | SJVMASSOHNFTKR-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=NN=C3N2C=C(C=C3)CCl |
Computed by PubChem (NCBI)