CAS 1351654-21-1 appears in our catalog under these names: 5-Azetidin-3-yl-3-phenyl-1,2,4-oxadiazole hydrochloride, 95%, 5-(Azetidin-3-yl)-3-phenyl-1,2,4-oxadiazole hydrochloride, 98%, 5-(Azetidin-3-yl)-3-phenyl-1,2,4-oxadiazole hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
5-(azetidin-3-yl)-3-phenyl-1,2,4-oxadiazole;hydrochloride (CAS 1351654-21-1) is a chemical compound with the molecular formula C11H12ClN3O and a molecular weight of 237.68 g/mol. IUPAC name: 5-(azetidin-3-yl)-3-phenyl-1,2,4-oxadiazole;hydrochloride. InChIKey: GSMGRPISFJYCHK-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 5-(azetidin-3-yl)-3-phenyl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | GSMGRPISFJYCHK-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=NC(=NO2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)