CAS 1338675-20-9 is the registry number for 4-(3-tert-Butyl-1,2,4-oxadiazol-5-yl)-2-chloropyridine, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-tert-butyl-5-(2-chloro-4-pyridinyl)-1,2,4-oxadiazole (CAS 1338675-20-9) is a chemical compound with the molecular formula C11H12ClN3O and a molecular weight of 237.68 g/mol. IUPAC name: 3-tert-butyl-5-(2-chloro-4-pyridinyl)-1,2,4-oxadiazole. InChIKey: APIBJYWBDXROGR-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 3-tert-butyl-5-(2-chloro-4-pyridinyl)-1,2,4-oxadiazole |
| InChIKey | APIBJYWBDXROGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=N1)C2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)