CAS 2434602-50-1 is the registry number for (S)-6-Chloro-4-(1-methoxyethyl)-1,5-naphthyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-[(1S)-1-methoxyethyl]-1,5-naphthyridin-3-amine (CAS 2434602-50-1) is a chemical compound with the molecular formula C11H12ClN3O and a molecular weight of 237.68 g/mol. IUPAC name: 6-chloro-4-[(1S)-1-methoxyethyl]-1,5-naphthyridin-3-amine. InChIKey: INXYSLHXGVMYJW-LURJTMIESA-N.
| Molecular formula | C11H12ClN3O |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 6-chloro-4-[(1S)-1-methoxyethyl]-1,5-naphthyridin-3-amine |
| InChIKey | INXYSLHXGVMYJW-LURJTMIESA-N |
| SMILES | C[C@@H](C1=C2C(=NC=C1N)C=CC(=N2)Cl)OC |
Computed by PubChem (NCBI)