Products 1119454-19-1
CAS 1119454-19-1 is the registry number for Methyl 5-chloro-2-(chlorosulfonyl)benzoate, 97%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg.
Methyl 5-chloro-2-chlorosulfonylbenzoate (CAS 1119454-19-1) is a chemical compound with the molecular formula C8H6Cl2O4S and a molecular weight of 269.10 g/mol. IUPAC name: methyl 5-chloro-2-chlorosulfonylbenzoate. InChIKey: CVFDLVIWIUKZBI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O4S |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | methyl 5-chloro-2-chlorosulfonylbenzoate |
| InChIKey | CVFDLVIWIUKZBI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)