CAS 4040-07-7 is the registry number for N-Phenyl-1,3,5-triazin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-phenyl-1,3,5-triazin-2-amine (CAS 4040-07-7) is a chemical compound with the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. IUPAC name: N-phenyl-1,3,5-triazin-2-amine. InChIKey: ZRHAGDPKFFHVEY-UHFFFAOYSA-N.
| Molecular formula | C9H8N4 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | N-phenyl-1,3,5-triazin-2-amine |
| InChIKey | ZRHAGDPKFFHVEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=NC=N2 |
Computed by PubChem (NCBI)