CAS 2259619-37-7 is the registry number for 1-Ethyl-1H-pyrazolo[4,3-b]pyridine-5-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethylpyrazolo[4,5-b]pyridine-5-carbonitrile (CAS 2259619-37-7) is a chemical compound with the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. IUPAC name: 1-ethylpyrazolo[4,5-b]pyridine-5-carbonitrile. InChIKey: AGCAOOBOLGDTFA-UHFFFAOYSA-N.
| Molecular formula | C9H8N4 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | 1-ethylpyrazolo[4,5-b]pyridine-5-carbonitrile |
| InChIKey | AGCAOOBOLGDTFA-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=N1)N=C(C=C2)C#N |
Computed by PubChem (NCBI)