CAS 220429-71-0 is the registry number for 5-(2-Phenylethenyl)-1h-1,2,3,4-tetrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-[(E)-2-phenylethenyl]-2H-tetrazole (CAS 220429-71-0) is a chemical compound with the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. IUPAC name: 5-[(E)-2-phenylethenyl]-2H-tetrazole. InChIKey: UHYGCMNTYAEAHI-VOTSOKGWSA-N.
| Molecular formula | C9H8N4 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | 5-[(E)-2-phenylethenyl]-2H-tetrazole |
| InChIKey | UHYGCMNTYAEAHI-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=NNN=N2 |
Computed by PubChem (NCBI)