CAS 111969-64-3 appears in our catalog under these names: L-Menthyl 2,2-Dihydroxyacetate, (1R,2S,5R)–2–Isopropyl–5–methylcyclohexyl 2,2–Dihydroxyacetate, (1R)-(-)-Menthyl glyoxylate monohydrate, 98% , (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2,2-Dihydroxyacetate, >98.0%(GC), (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2,2-dihydroxyacetate 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 25g, 5g, 100g, 250g, 500g, 10g.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate (CAS 111969-64-3) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate. InChIKey: BWZMJRSMHQDFIT-KXUCPTDWSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate |
| InChIKey | BWZMJRSMHQDFIT-KXUCPTDWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)C(O)O)C(C)C |
Computed by PubChem (NCBI)