CAS 1402543-99-0 is the registry number for 1-O-Dihydroxyacetyl-D-menthol. Offered by: TRC. Available pack sizes: 1g, 500mg, 5g.
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate (CAS 1402543-99-0) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate. InChIKey: BWZMJRSMHQDFIT-AEJSXWLSSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate |
| InChIKey | BWZMJRSMHQDFIT-AEJSXWLSSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)OC(=O)C(O)O)C(C)C |
Computed by PubChem (NCBI)