CAS 15941-53-4 appears in our catalog under these names: 3-Methyl-5-oxocyclohexane-1,2-dicarboxylic acid, 95%, 3-Methyl-5-oxocyclohexane-1,2-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methyl-5-oxocyclohexane-1,2-dicarboxylic acid (CAS 15941-53-4) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: 3-methyl-5-oxocyclohexane-1,2-dicarboxylic acid. InChIKey: FTECSEOMYYNPLN-UHFFFAOYSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-methyl-5-oxocyclohexane-1,2-dicarboxylic acid |
| InChIKey | FTECSEOMYYNPLN-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)CC(C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)