CAS 112101-77-6 is the registry number for (S)-3-(4’-Methoxy-3’-sulfonamidophenyl)-2-propylamine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
5-[(2S)-2-aminopropyl]-2-methoxybenzenesulfonamide;hydrochloride (CAS 112101-77-6) is a chemical compound with the molecular formula C10H17ClN2O3S and a molecular weight of 280.77 g/mol. IUPAC name: 5-[(2S)-2-aminopropyl]-2-methoxybenzenesulfonamide;hydrochloride. InChIKey: KYRRNJIOCLALJQ-FJXQXJEOSA-N.
| Molecular formula | C10H17ClN2O3S |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | 5-[(2S)-2-aminopropyl]-2-methoxybenzenesulfonamide;hydrochloride |
| InChIKey | KYRRNJIOCLALJQ-FJXQXJEOSA-N |
| SMILES | C[C@@H](CC1=CC(=C(C=C1)OC)S(=O)(=O)N)N.Cl |
Computed by PubChem (NCBI)