CAS 86225-65-2 appears in our catalog under these names: 3-(4’-Methoxy-3’-sulfonamidophenyl)-2-propylamine Hydrochloride, 3-(4'-Methoxy-3'-sulfonamidophenyl)-2-propylamine, hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
5-(2-aminopropyl)-2-methoxybenzenesulfonamide;hydrochloride (CAS 86225-65-2) is a chemical compound with the molecular formula C10H17ClN2O3S and a molecular weight of 280.77 g/mol. IUPAC name: 5-(2-aminopropyl)-2-methoxybenzenesulfonamide;hydrochloride. InChIKey: KYRRNJIOCLALJQ-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O3S |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | 5-(2-aminopropyl)-2-methoxybenzenesulfonamide;hydrochloride |
| InChIKey | KYRRNJIOCLALJQ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)OC)S(=O)(=O)N)N.Cl |
Computed by PubChem (NCBI)