Products 58921-07-6
CAS 58921-07-6 is the registry number for Amidephrine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-[1-hydroxy-2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrochloride (CAS 58921-07-6) is a chemical compound with the molecular formula C10H17ClN2O3S and a molecular weight of 280.77 g/mol. IUPAC name: N-[3-[1-hydroxy-2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrochloride. InChIKey: KROFTUPDCYHRPV-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O3S |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | N-[3-[1-hydroxy-2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrochloride |
| InChIKey | KROFTUPDCYHRPV-UHFFFAOYSA-N |
| SMILES | CNCC(C1=CC(=CC=C1)NS(=O)(=O)C)O.Cl |
Computed by PubChem (NCBI)