Products 893729-43-6
CAS 893729-43-6 is the registry number for 2-Chloro-1-(4-(1,1-dioxidotetrahydrothiophen-3-yl)piperazin-1-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]ethanone (CAS 893729-43-6) is a chemical compound with the molecular formula C10H17ClN2O3S and a molecular weight of 280.77 g/mol. IUPAC name: 2-chloro-1-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]ethanone. InChIKey: RRUBKTSBNZCODS-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O3S |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | 2-chloro-1-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]ethanone |
| InChIKey | RRUBKTSBNZCODS-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2CCN(CC2)C(=O)CCl |
Computed by PubChem (NCBI)