CAS 112106-16-8 appears in our catalog under these names: Brivaracetam Impurity 1, (R)-2-(2-(tert-Butoxy)-2-oxoethyl)pentanoic acid 97%, (R)-2-(2-(tert-Butoxy)-2-oxoethyl)pentanoic acid, 97%, 97%, (R)-2-(2-(tert-Butoxy)-2-oxoethyl)pentanoic acid, 95%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g, 100mg.
(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid (CAS 112106-16-8) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: (2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid. InChIKey: FPXXLDXAXQPOIJ-MRVPVSSYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | (2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
| InChIKey | FPXXLDXAXQPOIJ-MRVPVSSYSA-N |
| SMILES | CCC[C@H](CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)