Products 1122102-38-8
CAS 1122102-38-8 is the registry number for 2-Acetoxy-4-(Boc-amino)benzoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-acetyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1122102-38-8) is a chemical compound with the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. IUPAC name: 2-acetyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: QVLGGTILVUCZMC-UHFFFAOYSA-N.
| Molecular formula | C14H17NO6 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-acetyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | QVLGGTILVUCZMC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC(=C1)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)