Products 1122399-99-8
CAS 1122399-99-8 appears in our catalog under these names: rac O-Desmethyl Naproxen-d3, (±)-O-Desmethylnaproxen-d3 (alpha-methyl-d3), 99 atom % D, min 98% Chemical Purity, (Rac)-O-Desmethylnaproxen-d3. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 1mg, 0,01g, 0,005g, 10 mg, 1 mg.
3,3,3-trideuterio-2-(6-hydroxynaphthalen-2-yl)propanoic acid (CAS 1122399-99-8) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 219.25 g/mol. IUPAC name: 3,3,3-trideuterio-2-(6-hydroxynaphthalen-2-yl)propanoic acid. InChIKey: XWJUDDGELKXYNO-FIBGUPNXSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(6-hydroxynaphthalen-2-yl)propanoic acid |
| InChIKey | XWJUDDGELKXYNO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC2=C(C=C1)C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)