CAS 123050-98-6 appears in our catalog under these names: (R)-2-(6-Hydroxynaphthalen-2-yl)propanoic acid, 98%, (R)-O-Desmethyl Naproxen, (R)-O-Desmethyl Naproxen, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 5mg.
(2R)-2-(6-hydroxynaphthalen-2-yl)propanoic acid (CAS 123050-98-6) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: (2R)-2-(6-hydroxynaphthalen-2-yl)propanoic acid. InChIKey: XWJUDDGELKXYNO-MRVPVSSYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | (2R)-2-(6-hydroxynaphthalen-2-yl)propanoic acid |
| InChIKey | XWJUDDGELKXYNO-MRVPVSSYSA-N |
| SMILES | C[C@H](C1=CC2=C(C=C1)C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)