CAS 1123738-15-7 appears in our catalog under these names: 3-Bromoquinolin-5-ol, 96%, 3-Bromoquinolin-5-ol, 97%, 3-Bromoquinolin-5-ol, 96%, 96%, 3-Bromoquinolin-5-ol, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g, 100mg.
3-bromoquinolin-5-ol (CAS 1123738-15-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 3-bromoquinolin-5-ol. InChIKey: NJBHLUVEQVTPCC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 3-bromoquinolin-5-ol |
| InChIKey | NJBHLUVEQVTPCC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Br)C(=C1)O |
Computed by PubChem (NCBI)