CAS 1124198-90-8 is the registry number for 4–(4,4,4–Trifluoro–3–oxo–butyryl)–benzoic acid ethyl ester. Offered by: GLPBio. Available pack sizes: 200mg.
Ethyl 4-(4,4,4-trifluoro-3-oxobutanoyl)benzoate (CAS 1124198-90-8) is a chemical compound with the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. IUPAC name: ethyl 4-(4,4,4-trifluoro-3-oxobutanoyl)benzoate. InChIKey: KPEINOOPDGHQCH-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O4 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | ethyl 4-(4,4,4-trifluoro-3-oxobutanoyl)benzoate |
| InChIKey | KPEINOOPDGHQCH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)