CAS 1354819-34-3 is the registry number for 5-Hydroxy-4-(2-methoxy-5-(trifluoromethyl)phenyl)-5-methylfuran-2(5H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-4-[2-methoxy-5-(trifluoromethyl)phenyl]-5-methylfuran-2-one (CAS 1354819-34-3) is a chemical compound with the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. IUPAC name: 5-hydroxy-4-[2-methoxy-5-(trifluoromethyl)phenyl]-5-methylfuran-2-one. InChIKey: RZNMHJZKFSEFTP-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O4 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | 5-hydroxy-4-[2-methoxy-5-(trifluoromethyl)phenyl]-5-methylfuran-2-one |
| InChIKey | RZNMHJZKFSEFTP-UHFFFAOYSA-N |
| SMILES | CC1(C(=CC(=O)O1)C2=C(C=CC(=C2)C(F)(F)F)OC)O |
Computed by PubChem (NCBI)