Products 613240-19-0

CAS 613240-19-0 is the registry number for Ethyl 4-[4-(trifluoromethyl)phenyl]-2,4-dioxobutanoate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate (CAS 613240-19-0) is a chemical compound with the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. IUPAC name: ethyl 2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate. InChIKey: JHVRVXDQXHJMAK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11F3O4
Molecular weight288.22 g/mol
IUPAC nameethyl 2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate
InChIKeyJHVRVXDQXHJMAK-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F

Computed by PubChem (NCBI)