CAS 613240-19-0 is the registry number for Ethyl 4-[4-(trifluoromethyl)phenyl]-2,4-dioxobutanoate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate (CAS 613240-19-0) is a chemical compound with the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. IUPAC name: ethyl 2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate. InChIKey: JHVRVXDQXHJMAK-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O4 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | ethyl 2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate |
| InChIKey | JHVRVXDQXHJMAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)