CAS 1124382-65-5 appears in our catalog under these names: 6-Bromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 95%, 6-Bromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 98%, 98%, 6-BROMO-5-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
6-bromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1124382-65-5) is a chemical compound with the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. IUPAC name: 6-bromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: ZNPGWTXQRAGCLF-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4 |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 6-bromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | ZNPGWTXQRAGCLF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=NC(=NN12)N)Br |
Computed by PubChem (NCBI)