Products 2007915-41-3
CAS 2007915-41-3 appears in our catalog under these names: 6-Bromo-1-methyl-1h-pyrazolo[4,3-b]pyridin-3-amine, 95%, 6-Bromo-1-methyl-1H-pyrazolo[4,3-b]pyridin-3-amine, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, 10g.
6-bromo-1-methylpyrazolo[4,3-b]pyridin-3-amine (CAS 2007915-41-3) is a chemical compound with the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. IUPAC name: 6-bromo-1-methylpyrazolo[4,3-b]pyridin-3-amine. InChIKey: DQQIIPYLPFRMFP-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4 |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 6-bromo-1-methylpyrazolo[4,3-b]pyridin-3-amine |
| InChIKey | DQQIIPYLPFRMFP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=N1)N)N=CC(=C2)Br |
Computed by PubChem (NCBI)