CAS 1187386-21-5 is the registry number for 6-Bromo-3-ethyl-3H-[1,2,3]triazolo[4,5-b]pyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
6-bromo-3-ethyltriazolo[4,5-b]pyridine (CAS 1187386-21-5) is a chemical compound with the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. IUPAC name: 6-bromo-3-ethyltriazolo[4,5-b]pyridine. InChIKey: HHDNROAMANPDES-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4 |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 6-bromo-3-ethyltriazolo[4,5-b]pyridine |
| InChIKey | HHDNROAMANPDES-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=N2)Br)N=N1 |
Computed by PubChem (NCBI)