CAS 175965-69-2 is the registry number for 8-Bromo-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
8-bromo-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 175965-69-2) is a chemical compound with the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. IUPAC name: 8-bromo-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: GKOCPRWBWBTTLW-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4 |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 8-bromo-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | GKOCPRWBWBTTLW-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=N2)N)C(=C1)Br |
Computed by PubChem (NCBI)