CAS 112447-74-2 is the registry number for Dimethyl 1H-indole-4,5-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Dimethyl 1H-indole-4,5-dicarboxylate (CAS 112447-74-2) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: dimethyl 1H-indole-4,5-dicarboxylate. InChIKey: JYFILJZTUFKKCE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | dimethyl 1H-indole-4,5-dicarboxylate |
| InChIKey | JYFILJZTUFKKCE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(C=C1)NC=C2)C(=O)OC |
Computed by PubChem (NCBI)