Products 112471-82-6

CAS 112471-82-6 appears in our catalog under these names: H-Glu(ochex)-oh, 98%, L-Glutamic acid 5-cyclohexyl ester, 98+%, H–Glu(OcHex)–OH, H-L-Glu(OcHx)-OH, H-Glu(OcHex)-OH, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

(2S)-2-amino-5-cyclohexyloxy-5-oxopentanoic acid (CAS 112471-82-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2S)-2-amino-5-cyclohexyloxy-5-oxopentanoic acid. InChIKey: JSYMWKYNCWQUOY-VIFPVBQESA-N.

Identity
Molecular formulaC11H19NO4
Molecular weight229.27 g/mol
IUPAC name(2S)-2-amino-5-cyclohexyloxy-5-oxopentanoic acid
InChIKeyJSYMWKYNCWQUOY-VIFPVBQESA-N
SMILESC1CCC(CC1)OC(=O)CC[C@@H](C(=O)O)N

Computed by PubChem (NCBI)