CAS 112507-12-7 appears in our catalog under these names: Pyridoxine Impurity 9, Pyridoxine N-Oxide HCl, 3,4-Pyridinedimethanol, 5-Hydroxy-6-methyl-, 1-Oxide, Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
4,5-bis(hydroxymethyl)-2-methyl-1-oxidopyridin-1-ium-3-ol;hydrochloride (CAS 112507-12-7) is a chemical compound with the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. IUPAC name: 4,5-bis(hydroxymethyl)-2-methyl-1-oxidopyridin-1-ium-3-ol;hydrochloride. InChIKey: NUKXJGIMDVYDNB-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO4 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 4,5-bis(hydroxymethyl)-2-methyl-1-oxidopyridin-1-ium-3-ol;hydrochloride |
| InChIKey | NUKXJGIMDVYDNB-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=C(C(=C1O)CO)CO)[O-].Cl |
Computed by PubChem (NCBI)