CAS 49797-79-7 is the registry number for Pyridoxine Impurity 10 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,5-tris(hydroxymethyl)pyridin-3-ol;hydrochloride (CAS 49797-79-7) is a chemical compound with the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. IUPAC name: 2,4,5-tris(hydroxymethyl)pyridin-3-ol;hydrochloride. InChIKey: NROOWMBSNLDPFC-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO4 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 2,4,5-tris(hydroxymethyl)pyridin-3-ol;hydrochloride |
| InChIKey | NROOWMBSNLDPFC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)CO)O)CO)CO.Cl |
Computed by PubChem (NCBI)