CAS 1429199-81-4 is the registry number for Methyl (2R,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylate (CAS 1429199-81-4) is a chemical compound with the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. IUPAC name: methyl (2R,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylate. InChIKey: WTLYZPHPKZKYBR-NTSWFWBYSA-N.
| Molecular formula | C8H12ClNO4 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | methyl (2R,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylate |
| InChIKey | WTLYZPHPKZKYBR-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1C(=O)CCl)O |
Computed by PubChem (NCBI)