CAS 2228082-50-4 is the registry number for 3-(Amino(carboxy)methyl)bicyclo(1.1.1)pentane-1-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
3-[amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid;hydrochloride (CAS 2228082-50-4) is a chemical compound with the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. IUPAC name: 3-[amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid;hydrochloride. InChIKey: OBOBNIHNPPJHDP-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO4 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 3-[amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid;hydrochloride |
| InChIKey | OBOBNIHNPPJHDP-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)