CAS 112566-18-4 is the registry number for 2-Chloroimidazo(1,2-a)pyridine-3-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloroimidazo[1,2-a]pyridine-3-sulfonyl chloride (CAS 112566-18-4) is a chemical compound with the molecular formula C7H4Cl2N2O2S and a molecular weight of 251.09 g/mol. IUPAC name: 2-chloroimidazo[1,2-a]pyridine-3-sulfonyl chloride. InChIKey: SKFNUROCOVAKFR-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O2S |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 2-chloroimidazo[1,2-a]pyridine-3-sulfonyl chloride |
| InChIKey | SKFNUROCOVAKFR-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)