CAS 2137648-42-9 is the registry number for 5-Chloro-1H-pyrrolo(2,3-b)pyridine-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-chloro-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 2137648-42-9) is a chemical compound with the molecular formula C7H4Cl2N2O2S and a molecular weight of 251.09 g/mol. IUPAC name: 5-chloro-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: FQCWCGBYUHIURW-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O2S |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 5-chloro-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride |
| InChIKey | FQCWCGBYUHIURW-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)