CAS 2306270-26-6 appears in our catalog under these names: 3-Chloroimidazo[1,2-a]pyridine-6-sulfonyl chloride, 95%, 3-Chloroimidazo(1,2-a)pyridine-6-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-chloroimidazo[1,2-a]pyridine-6-sulfonyl chloride (CAS 2306270-26-6) is a chemical compound with the molecular formula C7H4Cl2N2O2S and a molecular weight of 251.09 g/mol. IUPAC name: 3-chloroimidazo[1,2-a]pyridine-6-sulfonyl chloride. InChIKey: JMIAEJORYLVZAM-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O2S |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 3-chloroimidazo[1,2-a]pyridine-6-sulfonyl chloride |
| InChIKey | JMIAEJORYLVZAM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)