CAS 2231234-21-0 is the registry number for 6-Chloro-1H-pyrrolo(2,3-b)pyridine-3-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
6-chloro-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 2231234-21-0) is a chemical compound with the molecular formula C7H4Cl2N2O2S and a molecular weight of 251.09 g/mol. IUPAC name: 6-chloro-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: VYMBTMKQYIDECM-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O2S |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 6-chloro-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride |
| InChIKey | VYMBTMKQYIDECM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CN2)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)