Products 1126621-87-1
CAS 1126621-87-1 appears in our catalog under these names: Piperazine-3,3,5,5-d4-N-t-BOC, 98 atom % D, min 98% Chemical Purity, N-Boc-piperazine-d4, N-Boc-piperazine-d4, 98.38%. Offered by: CDN, Biosynth, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100mg, 10 mg, 25 mg, 100 mg, 50 mg.
Tert-butyl 3,3,5,5-tetradeuteriopiperazine-1-carboxylate (CAS 1126621-87-1) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 190.28 g/mol. IUPAC name: tert-butyl 3,3,5,5-tetradeuteriopiperazine-1-carboxylate. InChIKey: CWXPZXBSDSIRCS-CQOLUAMGSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | tert-butyl 3,3,5,5-tetradeuteriopiperazine-1-carboxylate |
| InChIKey | CWXPZXBSDSIRCS-CQOLUAMGSA-N |
| SMILES | [2H]C1(CN(CC(N1)([2H])[2H])C(=O)OC(C)(C)C)[2H] |
Computed by PubChem (NCBI)