Products 112663-80-6
CAS 112663-80-6 appears in our catalog under these names: (S)-Benzyl 2-oxooxazolidine-5-carboxylate, 95%, (S)–benzyl 2–oxooxazolidine–5–carboxylate. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Benzyl (5S)-2-oxo-1,3-oxazolidine-5-carboxylate (CAS 112663-80-6) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: benzyl (5S)-2-oxo-1,3-oxazolidine-5-carboxylate. InChIKey: BXBOMORKYGQSFX-VIFPVBQESA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | benzyl (5S)-2-oxo-1,3-oxazolidine-5-carboxylate |
| InChIKey | BXBOMORKYGQSFX-VIFPVBQESA-N |
| SMILES | C1[C@H](OC(=O)N1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)