CAS 1126637-53-3 is the registry number for 4-Nitro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-nitro-1,3-benzoxazol-2-amine (CAS 1126637-53-3) is a chemical compound with the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. IUPAC name: 4-nitro-1,3-benzoxazol-2-amine. InChIKey: GLYRPQRCQMLKSM-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 4-nitro-1,3-benzoxazol-2-amine |
| InChIKey | GLYRPQRCQMLKSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=N2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)