CAS 1638763-65-1 appears in our catalog under these names: 4-Nitro-1h,2h,3h-pyrrolo[2,3-b]pyridin-2-one, 95%, 4-Nitro-1H-pyrrolo(2,3-b)pyridin-2(3H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.
4-nitro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1638763-65-1) is a chemical compound with the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. IUPAC name: 4-nitro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: WTLDHOARMFFBIQ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 4-nitro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | WTLDHOARMFFBIQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN=C2NC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)