CAS 155085-55-5 appears in our catalog under these names: 7-Hydroxy-1h-benzo[d][1,2,3]triazole-5-carboxylic acid, 95%, 7–Hydroxy–1H–benzo(d)(1,2,3)triazole–5–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg.
7-hydroxy-2H-benzotriazole-5-carboxylic acid (CAS 155085-55-5) is a chemical compound with the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. IUPAC name: 7-hydroxy-2H-benzotriazole-5-carboxylic acid. InChIKey: AICBDEMSWFCSTO-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 7-hydroxy-2H-benzotriazole-5-carboxylic acid |
| InChIKey | AICBDEMSWFCSTO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=NNN=C21)O)C(=O)O |
Computed by PubChem (NCBI)