CAS 66761-27-1 appears in our catalog under these names: 4-Azidosalicylic acid, 95%, 4-Azidosalicylic Acid(>90%), 4–Azidosalicylic Acid. Offered by: Combi-blocks, TRC, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-azido-5-hydroxybenzoic acid (CAS 66761-27-1) is a chemical compound with the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. IUPAC name: 3-azido-5-hydroxybenzoic acid. InChIKey: IMKRSVNNWZYMKI-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 3-azido-5-hydroxybenzoic acid |
| InChIKey | IMKRSVNNWZYMKI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N=[N+]=[N-])O)C(=O)O |
Computed by PubChem (NCBI)