CAS 1126650-56-3 appears in our catalog under these names: 3-Fluoro-3-phenylazetidine hydrochloride, 3-Fluoro-3-phenylazetidine hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg, 5g, 250mg, 1g.
3-fluoro-3-phenylazetidine;hydrochloride (CAS 1126650-56-3) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 3-fluoro-3-phenylazetidine;hydrochloride. InChIKey: IPIWGIZBRPGHKT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 3-fluoro-3-phenylazetidine;hydrochloride |
| InChIKey | IPIWGIZBRPGHKT-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=CC=C2)F.Cl |
Computed by PubChem (NCBI)