CAS 112725-89-0 appears in our catalog under these names: Mesalazine EP Impurity J, Mesalazine (Mesalamine) EP Impurity J, 3,5-Diamino-2-hydroxybenzoic acid, 95%, 3,5-Diaminosalicylic acid. Offered by: Chemat Brand, AmBeed, Biosynth, Fluorochem. Available pack sizes: on request, 5g, 100mg, 0,25g, 0,5g, 1g, 2g, 250mg.
3,5-diamino-2-hydroxybenzoic acid (CAS 112725-89-0) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3,5-diamino-2-hydroxybenzoic acid. InChIKey: HQURVGSRQBOZEX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3,5-diamino-2-hydroxybenzoic acid |
| InChIKey | HQURVGSRQBOZEX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)N)N |
Computed by PubChem (NCBI)