CAS 2514682-10-9 appears in our catalog under these names: Mesalazine (Mesalamine) EP Impurity J DiHCl, Mesalazine EP Impurity J DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-diamino-2-hydroxybenzoic acid (CAS 2514682-10-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3,5-diamino-2-hydroxybenzoic acid. InChIKey: HQURVGSRQBOZEX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3,5-diamino-2-hydroxybenzoic acid |
| InChIKey | HQURVGSRQBOZEX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)N)N |
Computed by PubChem (NCBI)