CAS 1128-40-1 appears in our catalog under these names: Methyl alpha-d-fucopyranoside, 98%, (2S,3R,4S,5R,6R)-2-Methoxy-6-methyltetrahydro-2H-pyran-3,4,5-triol, 95+%, Methyl α–D–fucopyranoside, Methyl a-D-fucopyranoside. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 1000mg, 500mg, 5000mg, 25000mg.
(2S,3R,4S,5R,6R)-2-methoxy-6-methyloxane-3,4,5-triol (CAS 1128-40-1) is a chemical compound with the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. IUPAC name: (2S,3R,4S,5R,6R)-2-methoxy-6-methyloxane-3,4,5-triol. InChIKey: OHWCAVRRXKJCRB-PZRMXXKTSA-N.
| Molecular formula | C7H14O5 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (2S,3R,4S,5R,6R)-2-methoxy-6-methyloxane-3,4,5-triol |
| InChIKey | OHWCAVRRXKJCRB-PZRMXXKTSA-N |
| SMILES | C[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC)O)O)O |
Computed by PubChem (NCBI)