Products 6743-62-0
CAS 6743-62-0 appears in our catalog under these names: Ethyl beta-d-xylopyranoside, 95%, Ethyl β–D–xylopyranoside, Ethyl β-D-xylopyranoside. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 1mg, 1000mg, 500mg, 2000mg, 5000mg.
(2R,3R,4S,5R)-2-ethoxyoxane-3,4,5-triol (CAS 6743-62-0) is a chemical compound with the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. IUPAC name: (2R,3R,4S,5R)-2-ethoxyoxane-3,4,5-triol. InChIKey: UBUITGRMYNAZAX-XZBKPIIZSA-N.
| Molecular formula | C7H14O5 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-ethoxyoxane-3,4,5-triol |
| InChIKey | UBUITGRMYNAZAX-XZBKPIIZSA-N |
| SMILES | CCO[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O |
Computed by PubChem (NCBI)