CAS 60762-64-3 is the registry number for (2S,3R,4R,5S)-2-((R)-1-Hydroxyethyl)-5-methoxytetrahydrofuran-3,4-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R,4R,5S)-2-[(1R)-1-hydroxyethyl]-5-methoxyoxolane-3,4-diol (CAS 60762-64-3) is a chemical compound with the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. IUPAC name: (2S,3R,4R,5S)-2-[(1R)-1-hydroxyethyl]-5-methoxyoxolane-3,4-diol. InChIKey: AYTNZNQTOUCWMA-OVHBTUCOSA-N.
| Molecular formula | C7H14O5 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (2S,3R,4R,5S)-2-[(1R)-1-hydroxyethyl]-5-methoxyoxolane-3,4-diol |
| InChIKey | AYTNZNQTOUCWMA-OVHBTUCOSA-N |
| SMILES | C[C@H]([C@H]1[C@@H]([C@H]([C@H](O1)OC)O)O)O |
Computed by PubChem (NCBI)